EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O4 |
| Net Charge | 0 |
| Average Mass | 340.504 |
| Monoisotopic Mass | 340.26136 |
| SMILES | CC/C=C/C(CC)CCC[C@@]1(CC)C[C@H](CC)[C@H](CC(=O)O)OO1 |
| InChI | InChI=1S/C20H36O4/c1-5-9-11-16(6-2)12-10-13-20(8-4)15-17(7-3)18(23-24-20)14-19(21)22/h9,11,16-18H,5-8,10,12-15H2,1-4H3,(H,21,22)/b11-9+/t16?,17-,18-,20-/m0/s1 |
| InChIKey | KCBAKIPOBYUWOG-QIKPMYDRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plakortide F free acid (CHEBI:78769) has role antifungal agent (CHEBI:35718) |
| plakortide F free acid (CHEBI:78769) has role marine metabolite (CHEBI:76507) |
| plakortide F free acid (CHEBI:78769) is a dioxanes (CHEBI:46926) |
| plakortide F free acid (CHEBI:78769) is a monocarboxylic acid (CHEBI:25384) |
| plakortide F free acid (CHEBI:78769) is a organic peroxide (CHEBI:25702) |
| plakortide F free acid (CHEBI:78769) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| {(3S,4S,6S)-4,6-diethyl-6-[(5E)-4-ethyloct-5-en-1-yl]-1,2-dioxan-3-yl}acetic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26001135 | Reaxys |
| Citations |
|---|