EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H46N3O4S |
| Net Charge | +1 |
| Average Mass | 568.804 |
| Monoisotopic Mass | 568.32035 |
| SMILES | [H][C@@]12CCCC[C@]1([H])C[NH+](C[C@@H](O)[C@H](CSc1ccccc1)NC(=O)c1cccc(O)c1C)[C@H](C(=O)NC(C)(C)C)C2 |
| InChI | InChI=1S/C32H45N3O4S/c1-21-25(15-10-16-28(21)36)30(38)33-26(20-40-24-13-6-5-7-14-24)29(37)19-35-18-23-12-9-8-11-22(23)17-27(35)31(39)34-32(2,3)4/h5-7,10,13-16,22-23,26-27,29,36-37H,8-9,11-12,17-20H2,1-4H3,(H,33,38)(H,34,39)/p+1/t22-,23+,26-,27-,29+/m0/s1 |
| InChIKey | QAGYKUNXZHXKMR-HKWSIXNMSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nelfinavir(1+) (CHEBI:78767) is a ammonium ion derivative (CHEBI:35274) |
| nelfinavir(1+) (CHEBI:78767) is a organic cation (CHEBI:25697) |
| nelfinavir(1+) (CHEBI:78767) is conjugate acid of nelfinavir (CHEBI:7496) |
| Incoming Relation(s) |
| nelfinavir mesylate (CHEBI:7497) has part nelfinavir(1+) (CHEBI:78767) |
| nelfinavir (CHEBI:7496) is conjugate base of nelfinavir(1+) (CHEBI:78767) |
| IUPAC Name |
|---|
| (3S,4aS,8aS)-3-(tert-butylcarbamoyl)-2-[(2R,3R)-2-hydroxy-3-[(3-hydroxy-2-methylbenzoyl)amino]-4-(phenylsulfanyl)butyl]decahydroisoquinolinium |
| Synonym | Source |
|---|---|
| nelfinavir cation | ChEBI |