EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H45N3O4S |
| Net Charge | 0 |
| Average Mass | 567.796 |
| Monoisotopic Mass | 567.31308 |
| SMILES | [H][C@@]12CCCC[C@]1([H])CN(C[C@@H](O)[C@H](CSc1ccccc1)NC(=O)c1cccc(O)c1C)[C@H](C(=O)NC(C)(C)C)C2 |
| InChI | InChI=1S/C32H45N3O4S/c1-21-25(15-10-16-28(21)36)30(38)33-26(20-40-24-13-6-5-7-14-24)29(37)19-35-18-23-12-9-8-11-22(23)17-27(35)31(39)34-32(2,3)4/h5-7,10,13-16,22-23,26-27,29,36-37H,8-9,11-12,17-20H2,1-4H3,(H,33,38)(H,34,39)/t22-,23+,26-,27-,29+/m0/s1 |
| InChIKey | QAGYKUNXZHXKMR-HKWSIXNMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nelfinavir (CHEBI:7496) has role antineoplastic agent (CHEBI:35610) |
| nelfinavir (CHEBI:7496) has role HIV protease inhibitor (CHEBI:35660) |
| nelfinavir (CHEBI:7496) is a aryl sulfide (CHEBI:35683) |
| nelfinavir (CHEBI:7496) is a benzamides (CHEBI:22702) |
| nelfinavir (CHEBI:7496) is a organic heterobicyclic compound (CHEBI:27171) |
| nelfinavir (CHEBI:7496) is a phenols (CHEBI:33853) |
| nelfinavir (CHEBI:7496) is a secondary alcohol (CHEBI:35681) |
| nelfinavir (CHEBI:7496) is a tertiary amino compound (CHEBI:50996) |
| nelfinavir (CHEBI:7496) is conjugate base of nelfinavir(1+) (CHEBI:78767) |
| Incoming Relation(s) |
| nelfinavir(1+) (CHEBI:78767) is conjugate acid of nelfinavir (CHEBI:7496) |
| IUPAC Name |
|---|
| (3S,4aS,8aS)-N-tert-butyl-2-[(2R,3R)-2-hydroxy-3-[(3-hydroxy-2-methylbenzoyl)amino]-4-(phenylsulfanyl)butyl]decahydroisoquinoline-3-carboxamide |
| INN | Source |
|---|---|
| nelfinavir | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| C07257 | KEGG COMPOUND |
| D08259 | KEGG DRUG |
| DB00220 | DrugBank |
| 1UN | PDBeChem |
| HMDB0014365 | HMDB |
| Nelfinavir | Wikipedia |
| LSM-5819 | LINCS |
| 1893 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7419619 | Reaxys |
| CAS:159989-64-7 | KEGG COMPOUND |
| CAS:159989-64-7 | ChemIDplus |
| Citations |
|---|