EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O3 |
| Net Charge | 0 |
| Average Mass | 296.451 |
| Monoisotopic Mass | 296.23514 |
| SMILES | CCCCC/C=C\C=C\[C@H](O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14,17,19H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+/t17-/m0/s1 |
| InChIKey | NPDSHTNEKLQQIJ-WXUVIADPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9(R)-HODE (CHEBI:78730) is a 9-HODE (CHEBI:72651) |
| 9(R)-HODE (CHEBI:78730) is conjugate acid of 9(R)-HODE(1−) (CHEBI:77895) |
| 9(R)-HODE (CHEBI:78730) is enantiomer of 9(S)-HODE (CHEBI:34496) |
| Incoming Relation(s) |
| 9(R)-HODE(1−) (CHEBI:77895) is conjugate base of 9(R)-HODE (CHEBI:78730) |
| 9(S)-HODE (CHEBI:34496) is enantiomer of 9(R)-HODE (CHEBI:78730) |
| IUPAC Name |
|---|
| (9R,10E,12Z)-9-hydroxyoctadeca-10,12-dienoic acid |
| Synonyms | Source |
|---|---|
| 9R-HODE | LIPID MAPS |
| 9R-hydroxy-10E,12Z-octadecadienoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000036 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4809204 | Reaxys |
| Citations |
|---|