EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31O3 |
| Net Charge | -1 |
| Average Mass | 295.443 |
| Monoisotopic Mass | 295.22787 |
| SMILES | CCCCC/C=C\C=C\[C@H](O)CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H32O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14,17,19H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/p-1/b8-6-,14-11+/t17-/m0/s1 |
| InChIKey | NPDSHTNEKLQQIJ-WXUVIADPSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9(R)-HODE(1−) (CHEBI:77895) is a HODE(1−) (CHEBI:131861) |
| 9(R)-HODE(1−) (CHEBI:77895) is a hydroxy fatty acid anion (CHEBI:59835) |
| 9(R)-HODE(1−) (CHEBI:77895) is a octadecanoid anion (CHEBI:131860) |
| 9(R)-HODE(1−) (CHEBI:77895) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| 9(R)-HODE(1−) (CHEBI:77895) is conjugate base of 9(R)-HODE (CHEBI:78730) |
| 9(R)-HODE(1−) (CHEBI:77895) is enantiomer of 9(S)-HODE(1−) (CHEBI:77852) |
| Incoming Relation(s) |
| 9(R)-HODE (CHEBI:78730) is conjugate acid of 9(R)-HODE(1−) (CHEBI:77895) |
| 9(S)-HODE(1−) (CHEBI:77852) is enantiomer of 9(R)-HODE(1−) (CHEBI:77895) |
| IUPAC Name |
|---|
| (9R,10E,12Z)-9-hydroxyoctadeca-10,12-dienoate |
| Synonym | Source |
|---|---|
| (9R)-hydroxy(10E,12Z)-octadecadienoate(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (9R)-hydroxy-(10E,12Z)-octadecadienoate | UniProt |
| Citations |
|---|