EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:78696 - cercosporamide
| Formula | C16H13NO7 |
| Net Charge | 0 |
| Average Mass | 331.280 |
| Monoisotopic Mass | 331.06920 |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(C(N)=O)c(O)cc(O)c3[C@]2(C)C1=O |
| InChI | InChI=1S/C16H13NO7/c1-5(18)10-7(20)4-9-16(2,14(10)22)12-8(21)3-6(19)11(15(17)23)13(12)24-9/h3-4,19-21H,1-2H3,(H2,17,23)/t16-/m1/s1 |
| InChIKey | GEWLYFZWVLXQME-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Biological Roles: | phytotoxin Any toxin produced by a plant. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cercosporamide (CHEBI:78696) has role antifungal agent (CHEBI:35718) |
| cercosporamide (CHEBI:78696) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| cercosporamide (CHEBI:78696) has role fungal metabolite (CHEBI:76946) |
| cercosporamide (CHEBI:78696) has role phytotoxin (CHEBI:38231) |
| cercosporamide (CHEBI:78696) is a dibenzofurans (CHEBI:38922) |
| cercosporamide (CHEBI:78696) is a methyl ketone (CHEBI:51867) |
| cercosporamide (CHEBI:78696) is a monocarboxylic acid amide (CHEBI:29347) |
| cercosporamide (CHEBI:78696) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (9aS)-8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxo-9,9a-dihydrodibenzo[b,d]furan-4-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| CN101292039 | Patent |
| EP1914313 | Patent |
| JP2008214336 | Patent |
| KR20080033345 | Patent |
| US2010152467 | Patent |
| WO2007018194 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5485233 | Reaxys |
| CAS:131436-22-1 | ChemIDplus |
| Citations |
|---|