EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13NO7 |
| Net Charge | 0 |
| Average Mass | 331.280 |
| Monoisotopic Mass | 331.06920 |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(C(N)=O)c(O)cc(O)c3[C@]2(C)C1=O |
| InChI | InChI=1S/C16H13NO7/c1-5(18)10-7(20)4-9-16(2,14(10)22)12-8(21)3-6(19)11(15(17)23)13(12)24-9/h3-4,19-21H,1-2H3,(H2,17,23)/t16-/m1/s1 |
| InChIKey | GEWLYFZWVLXQME-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. phytotoxin Any toxin produced by a plant. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cercosporamide (CHEBI:78696) has role antifungal agent (CHEBI:35718) |
| cercosporamide (CHEBI:78696) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| cercosporamide (CHEBI:78696) has role fungal metabolite (CHEBI:76946) |
| cercosporamide (CHEBI:78696) has role phytotoxin (CHEBI:38231) |
| cercosporamide (CHEBI:78696) is a dibenzofurans (CHEBI:38922) |
| cercosporamide (CHEBI:78696) is a methyl ketone (CHEBI:51867) |
| cercosporamide (CHEBI:78696) is a monocarboxylic acid amide (CHEBI:29347) |
| cercosporamide (CHEBI:78696) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (9aS)-8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxo-9,9a-dihydrodibenzo[b,d]furan-4-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| CN101292039 | Patent |
| EP1914313 | Patent |
| JP2008214336 | Patent |
| KR20080033345 | Patent |
| US2010152467 | Patent |
| WO2007018194 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5485233 | Reaxys |
| CAS:131436-22-1 | ChemIDplus |
| Citations |
|---|