EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O5 |
| Net Charge | 0 |
| Average Mass | 214.217 |
| Monoisotopic Mass | 214.08412 |
| SMILES | C[C@]1(C(=O)O)[C@@H]2CC[C@@H](O2)[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C10H14O5/c1-9(7(11)12)5-3-4-6(15-5)10(9,2)8(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/t5-,6+,9+,10- |
| InChIKey | NMTNUQBORQILRK-XCVPVQRUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor Any EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of phosphoprotein phosphatase (EC 3.1.3.16). hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cantharidic acid (CHEBI:78695) has functional parent cantharidin (CHEBI:64213) |
| cantharidic acid (CHEBI:78695) has role apoptosis inducer (CHEBI:68495) |
| cantharidic acid (CHEBI:78695) has role EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor (CHEBI:37153) |
| cantharidic acid (CHEBI:78695) has role hepatotoxic agent (CHEBI:50908) |
| cantharidic acid (CHEBI:78695) is a bridged compound (CHEBI:35990) |
| cantharidic acid (CHEBI:78695) is a dicarboxylic acid (CHEBI:35692) |
| cantharidic acid (CHEBI:78695) is a monoterpenoid (CHEBI:25409) |
| cantharidic acid (CHEBI:78695) is a oxabicycloalkane (CHEBI:46733) |
| IUPAC Name |
|---|
| (1R,2S,3R,4S)-2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| Cantharidic_acid | Wikipedia |
| WO2011056222 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:17311 | Reaxys |
| CAS:28874-45-5 | ChemIDplus |
| Citations |
|---|