EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | C[C@@]12C(=O)OC(=O)[C@]1(C)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C10H12O4/c1-9-5-3-4-6(13-5)10(9,2)8(12)14-7(9)11/h5-6H,3-4H2,1-2H3/t5-,6+,9+,10- |
| InChIKey | DHZBEENLJMYSHQ-XCVPVQRUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor Any EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of phosphoprotein phosphatase (EC 3.1.3.16). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cantharidin (CHEBI:64213) has role EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor (CHEBI:37153) |
| cantharidin (CHEBI:64213) has role herbicide (CHEBI:24527) |
| cantharidin (CHEBI:64213) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| cantharidin (CHEBI:64213) is a monoterpenoid (CHEBI:25409) |
| Incoming Relation(s) |
| cantharidic acid (CHEBI:78695) has functional parent cantharidin (CHEBI:64213) |
| IUPAC Name |
|---|
| (3aR,4S,7R,7aS)-3a,7a-dimethylhexahydro-4,7-epoxy-2-benzofuran-1,3-dione |
| Synonyms | Source |
|---|---|
| Cantharidine | ChemIDplus |
| 1,2-Dimethyl-3,6-epoxyperhydrophthalic anhydride | ChemIDplus |
| Cantharone | ChemIDplus |
| exo-1,2-cis-Dimethyl-3,6-epoxyhexahydrophthalic anhydride | ChemIDplus |
| Kantharidin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Cantharidin | Wikipedia |
| C16778 | KEGG COMPOUND |
| C00010979 | KNApSAcK |
| LSM-42705 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:85302 | Reaxys |
| CAS:56-25-7 | ChemIDplus |
| CAS:56-25-7 | KEGG COMPOUND |
| Citations |
|---|