EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | 0 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05282 |
| SMILES | CC(=O)c1c(O)cc(O)c(C(C)=O)c1O |
| InChI | InChI=1S/C10H10O5/c1-4(11)8-6(13)3-7(14)9(5(2)12)10(8)15/h3,13-15H,1-2H3 |
| InChIKey | PIFFQYJYNWXNGE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lysobacter gummosus (ncbitaxon:262324) | - | PubMed (18058176) | |
| Pseudomonas fluorescens PF5 (ncbitaxon:1218948) | - | PubMed (15826166) | |
| Pseudomonas protegens PF5 (ncbitaxon:220664) | - | PubMed (24742073) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-diacetylphloroglucinol (CHEBI:78688) has functional parent phloroglucinol (CHEBI:16204) |
| 2,4-diacetylphloroglucinol (CHEBI:78688) has role antifungal agent (CHEBI:35718) |
| 2,4-diacetylphloroglucinol (CHEBI:78688) has role bacterial metabolite (CHEBI:76969) |
| 2,4-diacetylphloroglucinol (CHEBI:78688) is a aromatic ketone (CHEBI:76224) |
| 2,4-diacetylphloroglucinol (CHEBI:78688) is a benzenetriol (CHEBI:22707) |
| 2,4-diacetylphloroglucinol (CHEBI:78688) is a diketone (CHEBI:46640) |
| 2,4-diacetylphloroglucinol (CHEBI:78688) is a methyl ketone (CHEBI:51867) |
| 2,4-diacetylphloroglucinol (CHEBI:78688) is conjugate acid of 2,4-diacetylphloroglucinol(1−) (CHEBI:140662) |
| Incoming Relation(s) |
| 2,4-diacetylphloroglucinol(1−) (CHEBI:140662) is conjugate base of 2,4-diacetylphloroglucinol (CHEBI:78688) |
| IUPAC Name |
|---|
| 1,1'-(2,4,6-trihydroxy-1,3-phenylene)diethanone |
| Synonyms | Source |
|---|---|
| 1,1'-(2,4,6-Trihydroxy-1,3-phenylene)bisethanone | ChemIDplus |
| diacetylphloroglucinol | ChEBI |
| 5-acetyl-2,4,6-trihydroxyacetophenone | ChEBI |
| 2,4,6-trihydroxy-1,3-diacetylbenzene | ChEBI |
| 1,5-diacetyl-2,4,6-trihydroxybenzene | ChEBI |
| 1-(3-acetyl-2,4,6-trihydroxyphenyl)ethanone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2,4-Diacetylphloroglucinol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1881572 | Reaxys |
| CAS:2161-86-6 | ChemIDplus |
| Citations |
|---|