EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9O5 |
| Net Charge | -1 |
| Average Mass | 209.177 |
| Monoisotopic Mass | 209.04555 |
| SMILES | CC(=O)c1c([O-])cc(O)c(C(C)=O)c1O |
| InChI | InChI=1S/C10H10O5/c1-4(11)8-6(13)3-7(14)9(5(2)12)10(8)15/h3,13-15H,1-2H3/p-1 |
| InChIKey | PIFFQYJYNWXNGE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-diacetylphloroglucinol(1−) (CHEBI:140662) has role antifungal agent (CHEBI:35718) |
| 2,4-diacetylphloroglucinol(1−) (CHEBI:140662) is a phenolate anion (CHEBI:50525) |
| 2,4-diacetylphloroglucinol(1−) (CHEBI:140662) is conjugate base of 2,4-diacetylphloroglucinol (CHEBI:78688) |
| Incoming Relation(s) |
| 2,4-diacetylphloroglucinol (CHEBI:78688) is conjugate acid of 2,4-diacetylphloroglucinol(1−) (CHEBI:140662) |
| IUPAC Name |
|---|
| 2,4-diacetyl-3,5-dihydroxyphenolate |
| UniProt Name | Source |
|---|---|
| 2,4-diacetylphloroglucinol | UniProt |