EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | O=C(O)/C=C/CCCCCCCO |
| InChI | InChI=1S/C10H18O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h6,8,11H,1-5,7,9H2,(H,12,13)/b8-6+ |
| InChIKey | QHBZHVUGQROELI-SOFGYWHQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-10-hydroxydec-2-enoic acid (CHEBI:78668) has role animal metabolite (CHEBI:75767) |
| (E)-10-hydroxydec-2-enoic acid (CHEBI:78668) has role geroprotector (CHEBI:176497) |
| (E)-10-hydroxydec-2-enoic acid (CHEBI:78668) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (E)-10-hydroxydec-2-enoic acid (CHEBI:78668) is a straight-chain fatty acid (CHEBI:59202) |
| (E)-10-hydroxydec-2-enoic acid (CHEBI:78668) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (E)-10-hydroxydec-2-enoic acid (CHEBI:78668) is a ω-hydroxy-medium-chain fatty acid (CHEBI:194303) |
| Incoming Relation(s) |
| icos#15 (CHEBI:79118) has functional parent (E)-10-hydroxydec-2-enoic acid (CHEBI:78668) |
| oscr#15 (CHEBI:79137) has functional parent (E)-10-hydroxydec-2-enoic acid (CHEBI:78668) |
| royal jelly (CHEBI:78665) has part (E)-10-hydroxydec-2-enoic acid (CHEBI:78668) |
| IUPAC Name |
|---|
| (2E)-10-hydroxydec-2-enoic acid |
| Synonyms | Source |
|---|---|
| (E)-10-hydroxy-2-decenoic acid | ChemIDplus |
| trans-10-hydroxydec-2-enoic acid | ChEBI |
| (2E)-10-hydroxy-2-decenoic acid | ChEBI |
| trans-10-hydroxy-2-decenoic acid | ChEBI |
| 10-hydroxy-2E-decenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050157 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1705452 | Reaxys |
| CAS:14113-05-4 | ChemIDplus |
| Citations |
|---|