EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H40N2O6 |
| Net Charge | 0 |
| Average Mass | 608.735 |
| Monoisotopic Mass | 608.28864 |
| SMILES | [H][C@]12Cc3ccc(cc3)Oc3cc(ccc3O)C[C@]3([H])c4cc(c(OC)cc4CCN3C)Oc3c(OC)c(OC)cc(c31)CCN2C |
| InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-32(41-3)33-21-27(24)28(38)17-23-8-11-30(40)31(18-23)44-26-9-6-22(7-10-26)16-29-35-25(13-15-39(29)2)20-34(42-4)36(43-5)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29+/m1/s1 |
| InChIKey | HGNHIFJNOKGSKI-WDYNHAJCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxyacanthine (CHEBI:7853) has parent hydride oxyacanthan (CHEBI:36323) |
| oxyacanthine (CHEBI:7853) is a bisbenzylisoquinoline alkaloid (CHEBI:133004) |
| oxyacanthine (CHEBI:7853) is a isoquinolines (CHEBI:24922) |
| oxyacanthine (CHEBI:7853) is a macrocycle (CHEBI:51026) |
| oxyacanthine (CHEBI:7853) is a phenols (CHEBI:33853) |
| oxyacanthine (CHEBI:7853) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 6,6',7-trimethoxy-2,2'-dimethyloxyacanthan-12'-ol |
| Synonyms | Source |
|---|---|
| Oxyacanthine | KEGG COMPOUND |
| oxycanthine | ChemIDplus |
| vinetine | ChEBI |