EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H30N2O2 |
| Net Charge | 0 |
| Average Mass | 474.604 |
| Monoisotopic Mass | 474.23073 |
| SMILES | [H][C@@]12Cc3cccc(c3)Oc3ccc(cc3)C[C@]3([H])NCCc4cccc(c43)Oc3ccc(c1c3)CCN2 |
| InChI | InChI=1S/C32H30N2O2/c1-3-22-17-26(5-1)35-25-10-7-21(8-11-25)18-30-32-24(14-16-34-30)4-2-6-31(32)36-27-12-9-23-13-15-33-29(19-22)28(23)20-27/h1-12,17,20,29-30,33-34H,13-16,18-19H2/t29-,30+/m1/s1 |
| InChIKey | MZSYZRMPLNZZJS-IHLOFXLRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxyacanthan (CHEBI:36323) is a bisbenzylisoquinoline alkaloid (CHEBI:133004) |
| oxyacanthan (CHEBI:36323) is a isoquinoline alkaloid fundamental parent (CHEBI:38515) |
| Incoming Relation(s) |
| oxyacanthine (CHEBI:7853) has parent hydride oxyacanthan (CHEBI:36323) |
| IUPAC Name |
|---|
| oxyacanthan |