EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C73H129N19O15 |
| Net Charge | 0 |
| Average Mass | 1512.953 |
| Monoisotopic Mass | 1511.99155 |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(N)=O)[C@@H](C)CC |
| InChI | InChI=1S/C73H129N19O15/c1-15-42(9)58(78)72(106)91-56(38-57(77)93)71(105)90-53(35-40(5)6)69(103)86-49(28-20-23-31-74)65(99)81-47(14)64(98)92-59(43(10)16-2)73(107)83-44(11)61(95)80-45(12)63(97)88-55(37-48-26-18-17-19-27-48)68(102)82-46(13)62(96)84-50(29-21-24-32-75)66(100)85-51(30-22-25-33-76)67(101)89-54(36-41(7)8)70(104)87-52(60(79)94)34-39(3)4/h17-19,26-27,39-47,49-56,58-59H,15-16,20-25,28-38,74-76,78H2,1-14H3,(H2,77,93)(H2,79,94)(H,80,95)(H,81,99)(H,82,102)(H,83,107)(H,84,96)(H,85,100)(H,86,103)(H,87,104)(H,88,97)(H,89,101)(H,90,105)(H,91,106)(H,92,98)/t42-,43-,44-,45-,46-,47-,49-,50-,51-,52-,53-,54-,55-,56-,58-,59-/m0/s1 |
| InChIKey | QTEDUQSFCPUIOH-UEUBVZDRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. venom A toxin used by animals and injected into their victims by a bite or sting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mastoparan-D (CHEBI:78514) has role antibacterial agent (CHEBI:33282) |
| mastoparan-D (CHEBI:78514) is a mastoparans (CHEBI:78506) |
| mastoparan-D (CHEBI:78514) is a peptidyl amide (CHEBI:15722) |
| IUPAC Name |
|---|
| L-isoleucyl-L-asparaginyl-L-leucyl-L-lysyl-L-alanyl-L-isoleucyl-L-alanyl-L-alanyl-L-phenylalanyl-L-alanyl-L-lysyl-L-lysyl-L-leucyl-L-leucinamide |
| Synonyms | Source |
|---|---|
| Ile-Asn-Leu-Lys-Ala-Ile-Ala-Ala-Phe-Ala-Lys-Lys-Leu-Leu-NH2 | ChEBI |
| Mast cell degranulating peptide (Vespa ducalis) | ChEBI |
| MP-D | ChEBI |
| Citations |
|---|