EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C78H138N20O16 |
| Net Charge | 0 |
| Average Mass | 1612.086 |
| Monoisotopic Mass | 1611.05997 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(N)=O)C(C)C)C(C)C |
| InChI | InChI=1S/C78H138N20O16/c1-14-47(12)64(98-75(111)61(41-100)94-70(106)55(29-19-23-33-81)90-73(109)58(37-44(6)7)92-69(105)54(28-18-22-32-80)88-67(103)51(83)35-42(2)3)78(114)97-63(46(10)11)77(113)95-60(40-99)74(110)93-59(38-49-39-85-52-26-16-15-25-50(49)52)72(108)86-48(13)66(102)87-53(27-17-21-31-79)68(104)89-56(30-20-24-34-82)71(107)96-62(45(8)9)76(112)91-57(65(84)101)36-43(4)5/h15-16,25-26,39,42-48,51,53-64,85,99-100H,14,17-24,27-38,40-41,79-83H2,1-13H3,(H2,84,101)(H,86,108)(H,87,102)(H,88,103)(H,89,104)(H,90,109)(H,91,112)(H,92,105)(H,93,110)(H,94,106)(H,95,113)(H,96,107)(H,97,114)(H,98,111)/t47-,48-,51-,53-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63-,64-/m0/s1 |
| InChIKey | NSFBOCKFBVQQKB-CQWNSWRRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. venom A toxin used by animals and injected into their victims by a bite or sting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mastoparan-B (CHEBI:78511) has role antibacterial agent (CHEBI:33282) |
| mastoparan-B (CHEBI:78511) is a mastoparans (CHEBI:78506) |
| mastoparan-B (CHEBI:78511) is a peptidyl amide (CHEBI:15722) |
| IUPAC Name |
|---|
| L-leucyl-L-lysyl-L-leucyl-L-lysyl-L-seryl-L-isoleucyl-L-valyl-L-seryl-L-tryptophyl-L-alanyl-L-lysyl-L-lysyl-L-valyl-L-leucinamide |
| Synonyms | Source |
|---|---|
| Leu-Lys-Leu-Lys-Ser-Ile-Val-Ser-Trp-Ala-Lys-Lys-Val-Leu-NH2 | ChEBI |
| Mast cell degranulating peptide (Vespa basalis) | ChemIDplus |
| MP-B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:137354-65-5 | ChemIDplus |
| Citations |
|---|