EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31FO5 |
| Net Charge | 0 |
| Average Mass | 418.505 |
| Monoisotopic Mass | 418.21555 |
| SMILES | [H][C@@]12CC[C@](OC(C)=O)(C(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](C)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C24H31FO5/c1-13-10-19-17-7-9-23(14(2)26,30-15(3)27)22(17,5)12-20(29)24(19,25)21(4)8-6-16(28)11-18(13)21/h6,8,11,13,17,19-20,29H,7,9-10,12H2,1-5H3/t13-,17-,19-,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | YRFXGQHBPBMFHW-SBTZIJSASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluorometholone acetate (CHEBI:78354) has functional parent fluorometholone (CHEBI:31625) |
| fluorometholone acetate (CHEBI:78354) has functional parent Δ1-progesterone (CHEBI:34073) |
| fluorometholone acetate (CHEBI:78354) has role anti-inflammatory drug (CHEBI:35472) |
| fluorometholone acetate (CHEBI:78354) is a 11β-hydroxy steroid (CHEBI:35346) |
| fluorometholone acetate (CHEBI:78354) is a 20-oxo steroid (CHEBI:36885) |
| fluorometholone acetate (CHEBI:78354) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| fluorometholone acetate (CHEBI:78354) is a acetate ester (CHEBI:47622) |
| fluorometholone acetate (CHEBI:78354) is a fluorinated steroid (CHEBI:50830) |
| fluorometholone acetate (CHEBI:78354) is a glucocorticoid (CHEBI:24261) |
| fluorometholone acetate (CHEBI:78354) is a steroid ester (CHEBI:47880) |
| IUPAC Names |
|---|
| (6α,11β)-9-fluoro-11-hydroxy-6-methyl-3,20-dioxopregna-1,4-dien-17-yl acetate |
| 9-fluoro-11β-hydroxy-6α-methyl-3,20-dioxopregna-1,4-dien-17-yl acetate |
| Synonyms | Source |
|---|---|
| 6alpha-Methyl-9alpha-fluoro-17-acetoxy-21-deoxyprednisolone | KEGG COMPOUND |
| 9-Fluoro-11beta,17-dihydroxy-6alpha-methylpregna-1,4-diene-3,20-dione 17-acetate | KEGG COMPOUND |
| 9-Fluoro-11beta,17-dihydroxy-6alpha-methylpregna-1,4-diene-3,20-dione 17-acetate | ChemIDplus |
| Fluorometholone 17-acetate | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Flarex | KEGG DRUG |
| Citations |
|---|