EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29FO4 |
| Net Charge | 0 |
| Average Mass | 376.468 |
| Monoisotopic Mass | 376.20499 |
| SMILES | [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](C)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C22H29FO4/c1-12-9-17-15-6-8-21(27,13(2)24)20(15,4)11-18(26)22(17,23)19(3)7-5-14(25)10-16(12)19/h5,7,10,12,15,17-18,26-27H,6,8-9,11H2,1-4H3/t12-,15-,17-,18-,19-,20-,21-,22-/m0/s1 |
| InChIKey | FAOZLTXFLGPHNG-KNAQIMQKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. anti-inflammatory agent Any compound that has anti-inflammatory effects. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluorometholone (CHEBI:31625) has functional parent Δ1-progesterone (CHEBI:34073) |
| fluorometholone (CHEBI:31625) has role anti-inflammatory agent (CHEBI:67079) |
| fluorometholone (CHEBI:31625) has role anti-inflammatory drug (CHEBI:35472) |
| fluorometholone (CHEBI:31625) has role ophthalmology drug (CHEBI:66981) |
| fluorometholone (CHEBI:31625) is a 11β-hydroxy steroid (CHEBI:35346) |
| fluorometholone (CHEBI:31625) is a 17α-hydroxy steroid (CHEBI:35342) |
| fluorometholone (CHEBI:31625) is a 20-oxo steroid (CHEBI:36885) |
| fluorometholone (CHEBI:31625) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| fluorometholone (CHEBI:31625) is a fluorinated steroid (CHEBI:50830) |
| fluorometholone (CHEBI:31625) is a glucocorticoid (CHEBI:24261) |
| fluorometholone (CHEBI:31625) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| fluorometholone acetate (CHEBI:78354) has functional parent fluorometholone (CHEBI:31625) |
| IUPAC Names |
|---|
| (6α,11β)-9-fluoro-11,17-dihydroxy-6-methylpregna-1,4-diene-3,20-dione |
| 9-fluoro-11β,17-dihydroxy-6α-methylpregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| fluorometholone | KEGG DRUG |
| fluorométholone | DrugBank |
| fluorometholonum | DrugBank |
| fluorometolona | DrugBank |
| Synonyms | Source |
|---|---|
| 9-Fluoro-11beta,17-dihydroxy-6alpha-methylpregna-1,4-diene-3,20-dione | ChemIDplus |
| Fluorometholon | DrugBank |
| NSC 33001 | KEGG DRUG |
| NSC-33001 | ChEMBL |
| Brand Names | Source |
|---|---|
| Fluaton | ChEMBL |
| Fluorometholone component of fml-s | ChEMBL |
| Fluor-op | KEGG DRUG |
| Fml | ChEMBL |
| Fml forte | ChEMBL |
| Fml fte | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1208 | DrugCentral |
| D01367 | KEGG DRUG |
| DB00324 | DrugBank |
| Fluorometholone | Wikipedia |
| HMDB0014469 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3172388 | Reaxys |
| CAS:426-13-1 | ChemIDplus |
| CAS:426-13-1 | KEGG DRUG |
| Citations |
|---|