EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6NO4 |
| Net Charge | -1 |
| Average Mass | 180.139 |
| Monoisotopic Mass | 180.03023 |
| SMILES | O=C([O-])Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H7NO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4H,5H2,(H,10,11)/p-1 |
| InChIKey | YBADLXQNJCMBKR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-nitrophenyl)acetate (CHEBI:78348) is a monocarboxylic acid anion (CHEBI:35757) |
| (4-nitrophenyl)acetate (CHEBI:78348) is conjugate base of (4-nitrophenyl)acetic acid (CHEBI:40443) |
| Incoming Relation(s) |
| (4-nitrophenyl)acetic acid (CHEBI:40443) is conjugate acid of (4-nitrophenyl)acetate (CHEBI:78348) |
| IUPAC Name |
|---|
| (4-nitrophenyl)acetate |
| Synonyms | Source |
|---|---|
| 2-(p-nitrophenyl)acetate | ChEBI |
| 4-nitrobenzeneacetate | ChEBI |
| 4-nitrophenylacetate | ChEBI |
| (p-nitrophenyl)acetate | ChEBI |
| p-nitrophenylacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3548398 | Reaxys |