EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO4 |
| Net Charge | 0 |
| Average Mass | 181.147 |
| Monoisotopic Mass | 181.03751 |
| SMILES | O=C(O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H7NO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4H,5H2,(H,10,11) |
| InChIKey | YBADLXQNJCMBKR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-nitrophenyl)acetic acid (CHEBI:40443) has functional parent phenylacetic acid (CHEBI:30745) |
| (4-nitrophenyl)acetic acid (CHEBI:40443) is a C-nitro compound (CHEBI:35716) |
| (4-nitrophenyl)acetic acid (CHEBI:40443) is a phenylacetic acids (CHEBI:25978) |
| (4-nitrophenyl)acetic acid (CHEBI:40443) is conjugate acid of (4-nitrophenyl)acetate (CHEBI:78348) |
| Incoming Relation(s) |
| (4-nitrophenyl)acetate (CHEBI:78348) is conjugate base of (4-nitrophenyl)acetic acid (CHEBI:40443) |
| IUPAC Name |
|---|
| (4-nitrophenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 2-(p-nitrophenyl)acetic acid | ChemIDplus |
| 4-nitrobenzeneacetic acid | ChemIDplus |
| 4-nitrophenylacetic acid | ChemIDplus |
| p-nitrophenylacetic acid | ChemIDplus |
| Citations |
|---|