EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O2 |
| Net Charge | 0 |
| Average Mass | 196.290 |
| Monoisotopic Mass | 196.14633 |
| SMILES | C=C[C@@](C)(CCC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C12H20O2/c1-6-12(5,14-11(4)13)9-7-8-10(2)3/h6,8H,1,7,9H2,2-5H3/t12-/m0/s1 |
| InChIKey | UWKAYLJWKGQEPM-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-linalyl acetate (CHEBI:78334) has role plant metabolite (CHEBI:76924) |
| (R)-linalyl acetate (CHEBI:78334) has role volatile oil component (CHEBI:27311) |
| (R)-linalyl acetate (CHEBI:78334) is a 3,7-dimethylocta-1,6-dien-3-yl acetate (CHEBI:78333) |
| (R)-linalyl acetate (CHEBI:78334) is enantiomer of (S)-linalyl acetate (CHEBI:78335) |
| Incoming Relation(s) |
| linalyl acetate (CHEBI:6469) has part (R)-linalyl acetate (CHEBI:78334) |
| (S)-linalyl acetate (CHEBI:78335) is enantiomer of (R)-linalyl acetate (CHEBI:78334) |
| IUPAC Name |
|---|
| (3R)-3,7-dimethylocta-1,6-dien-3-yl acetate |
| Synonym | Source |
|---|---|
| (−)-linalyl acetate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724499 | Reaxys |
| CAS:115-95-7 | KEGG COMPOUND |
| CAS:16509-46-9 | ChemIDplus |
| Citations |
|---|