EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O2 |
| Net Charge | 0 |
| Average Mass | 196.290 |
| Monoisotopic Mass | 196.14633 |
| SMILES | C=C[C@@](C)(CCC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C12H20O2/c1-6-12(5,14-11(4)13)9-7-8-10(2)3/h6,8H,1,7,9H2,2-5H3/t12-/m0/s1 |
| InChIKey | UWKAYLJWKGQEPM-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linalyl acetate (CHEBI:6469) has part (R)-linalyl acetate (CHEBI:78334) |
| linalyl acetate (CHEBI:6469) has part (S)-linalyl acetate (CHEBI:78335) |
| linalyl acetate (CHEBI:6469) has role antimicrobial agent (CHEBI:33281) |
| linalyl acetate (CHEBI:6469) has role flavouring agent (CHEBI:35617) |
| linalyl acetate (CHEBI:6469) has role food component (CHEBI:78295) |
| linalyl acetate (CHEBI:6469) is a racemate (CHEBI:60911) |
| IUPAC Name |
|---|
| rac-3,7-dimethylocta-1,6-dien-3-yl acetate |
| Synonyms | Source |
|---|---|
| (±)-3,7-dimethylocta-1,6-dien-3-yl acetate | ChEBI |
| Acetic acid linalool ester | HMDB |
| Bergamiol | HMDB |
| Bergamot mint oil | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C09863 | KEGG COMPOUND |
| HMDB0039522 | HMDB |
| Linalyl_acetate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724497 | Reaxys |
| CAS:115-95-7 | ChemIDplus |
| CAS:115-95-7 | KEGG COMPOUND |
| Citations |
|---|