EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2O |
| Net Charge | 0 |
| Average Mass | 242.322 |
| Monoisotopic Mass | 242.14191 |
| SMILES | [H][C@@]12C=C(C)C[C@@](N)(/C1=C/C)c1ccc(=O)nc1C2 |
| InChI | InChI=1S/C15H18N2O/c1-3-11-10-6-9(2)8-15(11,16)12-4-5-14(18)17-13(12)7-10/h3-6,10H,7-8,16H2,1-2H3,(H,17,18)/b11-3+/t10-,15+/m0/s1 |
| InChIKey | ZRJBHWIHUMBLCN-YQEJDHNASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Huperzia selago (ncbitaxon:70001) | - | PubMed (32708929) | |
| Huperzia serrata (ncbitaxon:355589) | - | PubMed (34072855) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| huperzine A (CHEBI:78330) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| huperzine A (CHEBI:78330) has role neuroprotective agent (CHEBI:63726) |
| huperzine A (CHEBI:78330) has role nootropic agent (CHEBI:66980) |
| huperzine A (CHEBI:78330) has role plant metabolite (CHEBI:76924) |
| huperzine A (CHEBI:78330) is a organic heterotricyclic compound (CHEBI:26979) |
| huperzine A (CHEBI:78330) is a primary amino compound (CHEBI:50994) |
| huperzine A (CHEBI:78330) is a pyridone (CHEBI:38183) |
| huperzine A (CHEBI:78330) is a sesquiterpene alkaloid (CHEBI:26657) |
| huperzine A (CHEBI:78330) is conjugate base of huperzine A(1+) (CHEBI:178022) |
| Incoming Relation(s) |
| huperzine A(1+) (CHEBI:178022) is conjugate acid of huperzine A (CHEBI:78330) |
| IUPAC Name |
|---|
| (5R,9R,11E)-5-amino-11-ethylidene-7-methyl-5,6,9,10-tetrahydro-5,9-methanocycloocta[b]pyridin-2(1H)-one |
| Synonyms | Source |
|---|---|
| (5R,9R,11E)-5-amino-11-ethylidene-5,6,9,10-tetrahydro-7-methyl-5,9-methanocycloocta[b]pyridin-2(1H)-one | ChEBI |
| Hup A | ChemIDplus |
| HupA | ChEBI |
| (−)-huperazine A | ChemIDplus |
| huperzine-A | ChEBI |
| hupzine A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 16736021 | ChemSpider |
| C00028361 | KNApSAcK |
| DB04864 | DrugBank |
| HMDB0242654 | HMDB |
| Huperzine_A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3592896 | Reaxys |
| CAS:102518-79-6 | ChemIDplus |
| Citations |
|---|