EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N2O |
| Net Charge | +1 |
| Average Mass | 243.330 |
| Monoisotopic Mass | 243.14919 |
| SMILES | [H][C@@]12C=C(C)C[C@@]([NH3+])(/C1=C/C)c1ccc(=O)nc1C2 |
| InChI | InChI=1S/C15H18N2O/c1-3-11-10-6-9(2)8-15(11,16)12-4-5-14(18)17-13(12)7-10/h3-6,10H,7-8,16H2,1-2H3,(H,17,18)/p+1/b11-3+/t10-,15+/m0/s1 |
| InChIKey | ZRJBHWIHUMBLCN-YQEJDHNASA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| huperzine A(1+) (CHEBI:178022) is a primary ammonium ion (CHEBI:65296) |
| huperzine A(1+) (CHEBI:178022) is conjugate acid of huperzine A (CHEBI:78330) |
| Incoming Relation(s) |
| huperzine A (CHEBI:78330) is conjugate base of huperzine A(1+) (CHEBI:178022) |
| IUPAC Name |
|---|
| (5R,9R,11E)-11-ethylidene-7-methyl-2-oxo-2,6,9,10-tetrahydro-5,9-methanocycloocta[b]pyridin-5(1H)-aminium |
| Synonyms | Source |
|---|---|
| huperzine A cation | ChEBI |
| Hup A(1+) | ChEBI |
| selagine(1+) | ChEBI |
| kimpukan A(1+) | ChEBI |
| (−)-selagine(1+) | ChEBI |
| (−)-huperazine A(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| huperzine A | UniProt |
| Citations |
|---|