EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:78309 - α-asarone
| Formula | C12H16O3 |
| Net Charge | 0 |
| Average Mass | 208.257 |
| Monoisotopic Mass | 208.10994 |
| SMILES | C/C=C/c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5+ |
| InChIKey | RKFAZBXYICVSKP-AATRIKPKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-asarone (CHEBI:78309) has role anticonvulsant (CHEBI:35623) |
| α-asarone (CHEBI:78309) has role GABA modulator (CHEBI:50268) |
| α-asarone (CHEBI:78309) is a asarone (CHEBI:78308) |
| IUPAC Name |
|---|
| 1,2,4-trimethoxy-5-[(1E)-prop-1-en-1-yl]benzene |
| Synonyms | Source |
|---|---|
| trans-1,2,4-trimethoxy-5-(1-propenyl)benzene | ChEBI |
| Asarone | ChemIDplus |
| trans-Isoasaron | ChemIDplus |
| trans-Isoasarone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Asarone | Wikipedia |
| HMDB0031469 | HMDB |
| C17846 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1910606 | Reaxys |
| CAS:2883-98-9 | ChemIDplus |
| CAS:2883-98-9 | KEGG COMPOUND |
| Citations |
|---|