EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O3 |
| Net Charge | 0 |
| Average Mass | 208.257 |
| Monoisotopic Mass | 208.10994 |
| SMILES | [H]C(C)=Cc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3 |
| InChIKey | RKFAZBXYICVSKP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asarone (CHEBI:78308) has role plant metabolite (CHEBI:76924) |
| asarone (CHEBI:78308) is a alkenylbenzene (CHEBI:195237) |
| asarone (CHEBI:78308) is a methoxybenzenes (CHEBI:51683) |
| asarone (CHEBI:78308) is a phenylpropanoid (CHEBI:26004) |
| Incoming Relation(s) |
| α-asarone (CHEBI:78309) is a asarone (CHEBI:78308) |
| β-asarone (CHEBI:10353) is a asarone (CHEBI:78308) |
| IUPAC Name |
|---|
| 1,2,4-trimethoxy-5-(prop-1-en-1-yl)benzene |
| Synonym | Source |
|---|---|
| 2,4,5-trimethoxy-1-propenylbenzene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2210026 | Reaxys |