EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20O |
| Net Charge | 0 |
| Average Mass | 144.258 |
| Monoisotopic Mass | 144.15142 |
| SMILES | CCCCCCCC(C)O |
| InChI | InChI=1S/C9H20O/c1-3-4-5-6-7-8-9(2)10/h9-10H,3-8H2,1-2H3 |
| InChIKey | NGDNVOAEIVQRFH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Asaia lannensis (ncbitaxon:415421) | - | PubMed (31108760 ) | |
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (17314143) | |
| Starmerella bacillaris (ncbitaxon:1247836) | - | MetaboLights (MTBLS212) | |
| Vitis vinifera (ncbitaxon:29760) | - | MetaboLights (MTBLS212) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonan-2-ol (CHEBI:78304) has role bacterial metabolite (CHEBI:76969) |
| nonan-2-ol (CHEBI:78304) has role flavouring agent (CHEBI:35617) |
| nonan-2-ol (CHEBI:78304) has role pheromone (CHEBI:26013) |
| nonan-2-ol (CHEBI:78304) has role plant metabolite (CHEBI:76924) |
| nonan-2-ol (CHEBI:78304) has role rat metabolite (CHEBI:86264) |
| nonan-2-ol (CHEBI:78304) has role volatile oil component (CHEBI:27311) |
| nonan-2-ol (CHEBI:78304) is a nonanol (CHEBI:195604) |
| nonan-2-ol (CHEBI:78304) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| (S)-1'-methyloctyl caffeate (CHEBI:70484) has functional parent nonan-2-ol (CHEBI:78304) |
| IUPAC Name |
|---|
| nonan-2-ol |
| Synonyms | Source |
|---|---|
| 1-methyl-1-octanol | ChEBI |
| 2-hydroxynonane | ChEBI |
| 2-nonanol | ChEBI |
| 2-nonyl alcohol | ChEBI |
| n-nonan-2-ol | NIST Chemistry WebBook |
| FEMA 3315 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2-Nonanol | Wikipedia |
| FDB012114 | FooDB |
| HMDB0033916 | HMDB |
| LMFA05000619 | LIPID MAPS |
| Citations |
|---|