EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | CCCCCCC[C@H](C)OC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H26O4/c1-3-4-5-6-7-8-14(2)22-18(21)12-10-15-9-11-16(19)17(20)13-15/h9-14,19-20H,3-8H2,1-2H3/b12-10+/t14-/m0/s1 |
| InChIKey | DEXGFPWDAXJBTA-WONIAPNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper sanguineispicum (IPNI:199083-2) | leaf (BTO:0000713) | PubMed (20954722) | 90% ethanolic extract of dried leaves |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-1'-methyloctyl caffeate (CHEBI:70484) has functional parent nonan-2-ol (CHEBI:78304) |
| (S)-1'-methyloctyl caffeate (CHEBI:70484) has role antileishmanial agent (CHEBI:70868) |
| (S)-1'-methyloctyl caffeate (CHEBI:70484) has role plant metabolite (CHEBI:76924) |
| (S)-1'-methyloctyl caffeate (CHEBI:70484) is a alkyl caffeate ester (CHEBI:65331) |
| IUPAC Name |
|---|
| (2S)-nonan-2-yl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21092027 | Reaxys |
| Citations |
|---|