EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | CCCCC(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C12H14O4/c1-2-3-8-11(13)16-10-7-5-4-6-9(10)12(14)15/h4-7H,2-3,8H2,1H3,(H,14,15) |
| InChIKey | WJHZBTMHUNVIKC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valerylsalicylic acid (CHEBI:78250) has functional parent salicylic acid (CHEBI:16914) |
| valerylsalicylic acid (CHEBI:78250) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| valerylsalicylic acid (CHEBI:78250) is a benzoic acids (CHEBI:22723) |
| valerylsalicylic acid (CHEBI:78250) is a salicylates (CHEBI:26596) |
| valerylsalicylic acid (CHEBI:78250) is a valerate ester (CHEBI:50871) |
| IUPAC Name |
|---|
| 2-(pentanoyloxy)benzoic acid |
| Synonyms | Source |
|---|---|
| 2-pentanoyloxybenzoic acid | ChEBI |
| 2-valeryloxybenzoic acid | ChEBI |
| O-pentanoylsalicylic acid | ChEBI |
| O-valerylsalicylic acid | ChEBI |
| Salicylic acid, valerate | ChemIDplus |
| valeryl salicylate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-25643 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3292055 | Reaxys |
| CAS:64206-54-8 | ChemIDplus |
| Citations |
|---|