EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N3O2S |
| Net Charge | +1 |
| Average Mass | 266.346 |
| Monoisotopic Mass | 266.09577 |
| SMILES | Cc1ncc(C[n+]2csc(CCO)c2C)c(O)n1 |
| InChI | InChI=1S/C12H15N3O2S/c1-8-11(3-4-16)18-7-15(8)6-10-5-13-9(2)14-12(10)17/h5,7,16H,3-4,6H2,1-2H3/p+1 |
| InChIKey | SRDGSXVLAVRBLU-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Roles: | vitamin B1 antagonist An antagonist which acts by inhibiting the action of vitamin B1 antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxythiamine(1+) (CHEBI:78249) has role antimetabolite (CHEBI:35221) |
| oxythiamine(1+) (CHEBI:78249) has role vitamin B1 antagonist (CHEBI:78248) |
| oxythiamine(1+) (CHEBI:78249) is a 1,3-thiazolium cation (CHEBI:63048) |
| Incoming Relation(s) |
| oxythiamine chloride (CHEBI:78246) has part oxythiamine(1+) (CHEBI:78249) |
| IUPAC Name |
|---|
| 5-(2-hydroxyethyl)-4-methyl-3-[(2-methyl-4-oxo-1,4-dihydropyrimidin-5-yl)methyl]-1,3-thiazol-3-ium |
| Synonyms | Source |
|---|---|
| oxythiamine | ChEBI |
| Hydroxythiamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4153910 | Reaxys |
| CAS:136-16-3 | ChemIDplus |
| Citations |
|---|