EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N3O2S |
| Net Charge | +1 |
| Average Mass | 266.346 |
| Monoisotopic Mass | 266.09577 |
| SMILES | Cc1ncc(C[n+]2csc(CCO)c2C)c(O)n1 |
| InChI | InChI=1S/C12H15N3O2S/c1-8-11(3-4-16)18-7-15(8)6-10-5-13-9(2)14-12(10)17/h5,7,16H,3-4,6H2,1-2H3/p+1 |
| InChIKey | SRDGSXVLAVRBLU-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. vitamin B1 antagonist An antagonist which acts by inhibiting the action of vitamin B1 |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxythiamine(1+) (CHEBI:78249) has role antimetabolite (CHEBI:35221) |
| oxythiamine(1+) (CHEBI:78249) has role vitamin B1 antagonist (CHEBI:78248) |
| oxythiamine(1+) (CHEBI:78249) is a 1,3-thiazolium cation (CHEBI:63048) |
| Incoming Relation(s) |
| oxythiamine chloride (CHEBI:78246) has part oxythiamine(1+) (CHEBI:78249) |
| IUPAC Name |
|---|
| 5-(2-hydroxyethyl)-4-methyl-3-[(2-methyl-4-oxo-1,4-dihydropyrimidin-5-yl)methyl]-1,3-thiazol-3-ium |
| Synonyms | Source |
|---|---|
| Hydroxythiamine | ChemIDplus |
| oxythiamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4153910 | Reaxys |
| CAS:136-16-3 | ChemIDplus |
| Citations |
|---|