EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N3O2S.Cl |
| Net Charge | 0 |
| Average Mass | 301.799 |
| Monoisotopic Mass | 301.06518 |
| SMILES | Cc1ncc(C[n+]2csc(CCO)c2C)c(O)n1.[Cl-] |
| InChI | InChI=1S/C12H15N3O2S.ClH/c1-8-11(3-4-16)18-7-15(8)6-10-5-13-9(2)14-12(10)17;/h5,7,16H,3-4,6H2,1-2H3;1H |
| InChIKey | RNUAEUWXRHCGKX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. vitamin B1 antagonist An antagonist which acts by inhibiting the action of vitamin B1 |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxythiamine chloride (CHEBI:78246) has part oxythiamine(1+) (CHEBI:78249) |
| oxythiamine chloride (CHEBI:78246) has role antimetabolite (CHEBI:35221) |
| oxythiamine chloride (CHEBI:78246) has role vitamin B1 antagonist (CHEBI:78248) |
| oxythiamine chloride (CHEBI:78246) is a organic chloride salt (CHEBI:36094) |
| Incoming Relation(s) |
| oxythiamine chloride hydrochloride (CHEBI:78244) has part oxythiamine chloride (CHEBI:78246) |
| IUPAC Name |
|---|
| 5-(2-hydroxyethyl)-4-methyl-3-[(2-methyl-4-oxo-1,4-dihydropyrimidin-5-yl)methyl]-1,3-thiazol-3-ium chloride |
| Synonyms | Source |
|---|---|
| 4-Hydroxythiamine | ChemIDplus |
| Hydroxythiamine | ChemIDplus |
| oxythiamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5326755 | Reaxys |
| CAS:582-36-5 | ChemIDplus |
| Citations |
|---|