EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10ClN |
| Net Charge | 0 |
| Average Mass | 107.584 |
| Monoisotopic Mass | 107.05018 |
| SMILES | CN(C)CCCl |
| InChI | InChI=1S/C4H10ClN/c1-6(2)4-3-5/h3-4H2,1-2H3 |
| InChIKey | WQMAANNAZKNUDL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-dimethylaminoethyl chloride (CHEBI:78155) is a organochlorine compound (CHEBI:36683) |
| 2-dimethylaminoethyl chloride (CHEBI:78155) is a tertiary amino compound (CHEBI:50996) |
| 2-dimethylaminoethyl chloride (CHEBI:78155) is conjugate base of 2-dimethylammonioethyl chloride (CHEBI:78154) |
| Incoming Relation(s) |
| 2-dimethylammonioethyl chloride (CHEBI:78154) is conjugate acid of 2-dimethylaminoethyl chloride (CHEBI:78155) |
| IUPAC Name |
|---|
| 2-chloro-N,N-dimethylethanamine |
| Synonyms | Source |
|---|---|
| Nitrogen half mustard | ChemIDplus |
| beta-Chloroethyldimethylamine | ChemIDplus |
| (2-Chloroethyl)dimethylamine | ChemIDplus |
| 2-Dimethylaminoethyl chloride | ChemIDplus |
| Chloro(dimethylamino)ethane | ChemIDplus |
| Dimethyl(2-chloroethyl)amine | ChemIDplus |