EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11ClN |
| Net Charge | +1 |
| Average Mass | 108.592 |
| Monoisotopic Mass | 108.05745 |
| SMILES | C[NH+](C)CCCl |
| InChI | InChI=1S/C4H10ClN/c1-6(2)4-3-5/h3-4H2,1-2H3/p+1 |
| InChIKey | WQMAANNAZKNUDL-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-dimethylammonioethyl chloride (CHEBI:78154) is a ammonium ion derivative (CHEBI:35274) |
| 2-dimethylammonioethyl chloride (CHEBI:78154) is a organic cation (CHEBI:25697) |
| 2-dimethylammonioethyl chloride (CHEBI:78154) is conjugate acid of 2-dimethylaminoethyl chloride (CHEBI:78155) |
| Incoming Relation(s) |
| 2-dimethylaminoethyl chloride hydrochloride (CHEBI:78153) has part 2-dimethylammonioethyl chloride (CHEBI:78154) |
| 2-dimethylaminoethyl chloride (CHEBI:78155) is conjugate base of 2-dimethylammonioethyl chloride (CHEBI:78154) |
| IUPAC Name |
|---|
| 2-chloro-N,N-dimethylethanaminium |