EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O7 |
| Net Charge | 0 |
| Average Mass | 190.107 |
| Monoisotopic Mass | 190.01135 |
| SMILES | O=C(O)CC(C(=O)O)C(=O)C(=O)O |
| InChI | InChI=1S/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13) |
| InChIKey | UFSCUAXLTRFIDC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxalosuccinic acid (CHEBI:7815) has functional parent 2-oxoglutaric acid (CHEBI:30915) |
| oxalosuccinic acid (CHEBI:7815) has role fundamental metabolite (CHEBI:78675) |
| oxalosuccinic acid (CHEBI:7815) is a tricarboxylic acid (CHEBI:27093) |
| oxalosuccinic acid (CHEBI:7815) is conjugate acid of oxalatosuccinate(3−) (CHEBI:58931) |
| Incoming Relation(s) |
| (S)-oxalosuccinic acid (CHEBI:44712) is a oxalosuccinic acid (CHEBI:7815) |
| oxalatosuccinate(3−) (CHEBI:58931) is conjugate base of oxalosuccinic acid (CHEBI:7815) |
| IUPAC Name |
|---|
| 1-oxopropane-1,2,3-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 1-oxopropane-1,2,3-tricarboxylate | IUBMB |
| Oxalbernsteinsäure | ChEBI |
| Oxalosuccinate | KEGG COMPOUND |
| Oxalosuccinic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05379 | KEGG COMPOUND |
| HMDB0003974 | HMDB |
| Oxalosuccinic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1790215 | Reaxys |
| CAS:1948-82-9 | KEGG COMPOUND |
| CAS:1948-82-9 | ChemIDplus |
| Citations |
|---|