EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3O7 |
| Net Charge | -3 |
| Average Mass | 187.083 |
| Monoisotopic Mass | 186.98952 |
| SMILES | O=C([O-])CC(C(=O)[O-])C(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3 |
| InChIKey | UFSCUAXLTRFIDC-UHFFFAOYSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxalatosuccinate(3−) (CHEBI:58931) has role fundamental metabolite (CHEBI:78675) |
| oxalatosuccinate(3−) (CHEBI:58931) is a tricarboxylic acid trianion (CHEBI:27092) |
| oxalatosuccinate(3−) (CHEBI:58931) is conjugate base of oxalosuccinic acid (CHEBI:7815) |
| Incoming Relation(s) |
| (S)-oxalatosuccinate(3−) (CHEBI:153066) is a oxalatosuccinate(3−) (CHEBI:58931) |
| oxalosuccinic acid (CHEBI:7815) is conjugate acid of oxalatosuccinate(3−) (CHEBI:58931) |
| IUPAC Name |
|---|
| 1-oxopropane-1,2,3-tricarboxylate |