EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O5S |
| Net Charge | 0 |
| Average Mass | 401.444 |
| Monoisotopic Mass | 401.10454 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)c1c(-c2ccccc2)noc1C |
| InChI | InChI=1S/C19H19N3O5S/c1-9-11(12(21-27-9)10-7-5-4-6-8-10)15(23)20-13-16(24)22-14(18(25)26)19(2,3)28-17(13)22/h4-8,13-14,17H,1-3H3,(H,20,23)(H,25,26)/t13-,14+,17-/m1/s1 |
| InChIKey | UWYHMGVUTGAWSP-JKIFEVAISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxacillin (CHEBI:7809) has role antibacterial agent (CHEBI:33282) |
| oxacillin (CHEBI:7809) has role antibacterial drug (CHEBI:36047) |
| oxacillin (CHEBI:7809) is a penicillin (CHEBI:17334) |
| oxacillin (CHEBI:7809) is conjugate acid of oxacillin(1−) (CHEBI:52132) |
| Incoming Relation(s) |
| cloxacillin (CHEBI:49566) has functional parent oxacillin (CHEBI:7809) |
| oxacillin(1−) (CHEBI:52132) is conjugate base of oxacillin (CHEBI:7809) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-(5-methyl-3-phenyl-1,2-oxazole-4-carboxamido)penam-3α-carboxylic acid |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-6-{[(5-methyl-3-phenylisoxazol-4-yl)carbonyl]amino}-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| (5-methyl-3-phenyl-4-isoxazolyl)penicillin | ChemIDplus |
| 5-methyl-3-phenyl-4-isoxazolyl-penicillin | ChemIDplus |
| 6β-(5-methyl-3-phenylisoxazol-4-yl)penicillanic acid | ChEBI |
| Oxacillin | KEGG COMPOUND |
| oxazocillin | ChemIDplus |
| Citations |
|---|