EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N3O5S |
| Net Charge | -1 |
| Average Mass | 400.436 |
| Monoisotopic Mass | 400.09727 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)c1c(-c2ccccc2)noc1C |
| InChI | InChI=1S/C19H19N3O5S/c1-9-11(12(21-27-9)10-7-5-4-6-8-10)15(23)20-13-16(24)22-14(18(25)26)19(2,3)28-17(13)22/h4-8,13-14,17H,1-3H3,(H,20,23)(H,25,26)/p-1/t13-,14+,17-/m1/s1 |
| InChIKey | UWYHMGVUTGAWSP-JKIFEVAISA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxacillin(1−) (CHEBI:52132) is a penicillinate anion (CHEBI:51356) |
| oxacillin(1−) (CHEBI:52132) is conjugate base of oxacillin (CHEBI:7809) |
| Incoming Relation(s) |
| oxacillin sodium (CHEBI:52134) has part oxacillin(1−) (CHEBI:52132) |
| oxacillin (CHEBI:7809) is conjugate acid of oxacillin(1−) (CHEBI:52132) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-(5-methyl-3-phenyl-1,2-oxazole-4-carboxamido)penam-3α-carboxylate |
| Synonym | Source |
|---|---|
| 6β-(5-methyl-3-phenylisoxazol-4-yl)penicillanate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4278284 | Beilstein |