EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O4 |
| Net Charge | 0 |
| Average Mass | 350.499 |
| Monoisotopic Mass | 350.24571 |
| SMILES | CCCCC/C=C\C[C@H](/C=C/C=C\C/C=C\CCCC(=O)OC)OO |
| InChI | InChI=1S/C21H34O4/c1-3-4-5-6-11-14-17-20(25-23)18-15-12-9-7-8-10-13-16-19-21(22)24-2/h8-12,14-15,18,20,23H,3-7,13,16-17,19H2,1-2H3/b10-8-,12-9-,14-11-,18-15+/t20-/m1/s1 |
| InChIKey | BCEKIAHCCATNGN-MSTIVACSSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12(R)-HPETE methyl ester (CHEBI:78034) has functional parent 12(R)-HPETE (CHEBI:34145) |
| 12(R)-HPETE methyl ester (CHEBI:78034) has functional parent methyl arachidonate (CHEBI:78033) |
| 12(R)-HPETE methyl ester (CHEBI:78034) is a fatty acid methyl ester (CHEBI:4986) |
| 12(R)-HPETE methyl ester (CHEBI:78034) is a hydroperoxy fatty ester (CHEBI:145037) |
| 12(R)-HPETE methyl ester (CHEBI:78034) is enantiomer of 12(S)-HPETE methyl ester (CHEBI:78035) |
| Incoming Relation(s) |
| 12(S)-HPETE methyl ester (CHEBI:78035) is enantiomer of 12(R)-HPETE methyl ester (CHEBI:78034) |
| IUPAC Name |
|---|
| methyl (5Z,8Z,10E,12R,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoate |
| Synonym | Source |
|---|---|
| methyl (5Z,8Z,10E,12R,14Z)-hydroperoxyicosatetraenoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 1-O-methyl (5Z,8Z,10E,12R,14Z)-hydroperoxyiecosatetraenoate | UniProt |