EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC/C=C\C[C@H](/C=C/C=C\C/C=C\CCCC(=O)O)OO |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h7-11,13-14,17,19,23H,2-6,12,15-16,18H2,1H3,(H,21,22)/b9-7-,11-8-,13-10-,17-14+/t19-/m1/s1 |
| InChIKey | ZIOZYRSDNLNNNJ-ZYBDYUKJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12(R)-HPETE (CHEBI:34145) has functional parent icosa-5,8,10,14-tetraenoic acid (CHEBI:36039) |
| 12(R)-HPETE (CHEBI:34145) has role mouse metabolite (CHEBI:75771) |
| 12(R)-HPETE (CHEBI:34145) is a HPETE (CHEBI:24644) |
| 12(R)-HPETE (CHEBI:34145) is conjugate acid of 12(R)-HPETE(1−) (CHEBI:75230) |
| 12(R)-HPETE (CHEBI:34145) is enantiomer of 12(S)-HPETE (CHEBI:15626) |
| Incoming Relation(s) |
| 12(R)-HPETE methyl ester (CHEBI:78034) has functional parent 12(R)-HPETE (CHEBI:34145) |
| 12(R)-HPETE(1−) (CHEBI:75230) is conjugate base of 12(R)-HPETE (CHEBI:34145) |
| 12(S)-HPETE (CHEBI:15626) is enantiomer of 12(R)-HPETE (CHEBI:34145) |
| IUPAC Name |
|---|
| (5Z,8Z,10E,12R,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 12(R)-HPETE | KEGG COMPOUND |
| (5Z,8Z,10E,14Z)-(12R)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoic acid | KEGG COMPOUND |
| (5Z,8Z,10E,14Z)-(12R)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14812 | KEGG COMPOUND |
| LMFA03060070 | LIPID MAPS |