EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11O5 |
| Net Charge | -1 |
| Average Mass | 283.259 |
| Monoisotopic Mass | 283.06120 |
| SMILES | COc1ccc(-c2coc3cc([O-])ccc3c2=O)cc1O |
| InChI | InChI=1S/C16H12O5/c1-20-14-5-2-9(6-13(14)18)12-8-21-15-7-10(17)3-4-11(15)16(12)19/h2-8,17-18H,1H3/p-1 |
| InChIKey | ZZAJQOPSWWVMBI-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calycosin(1−) (CHEBI:77992) has role antioxidant (CHEBI:22586) |
| calycosin(1−) (CHEBI:77992) has role metabolite (CHEBI:25212) |
| calycosin(1−) (CHEBI:77992) is a flavonoid oxoanion (CHEBI:60038) |
| calycosin(1−) (CHEBI:77992) is conjugate base of calycosin (CHEBI:17793) |
| Incoming Relation(s) |
| calycosin (CHEBI:17793) is conjugate acid of calycosin(1−) (CHEBI:77992) |
| IUPAC Name |
|---|
| 3-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-olate |
| UniProt Name | Source |
|---|---|
| calycosin | UniProt |