EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1ccc(-c2coc3cc(O)ccc3c2=O)cc1O |
| InChI | InChI=1S/C16H12O5/c1-20-14-5-2-9(6-13(14)18)12-8-21-15-7-10(17)3-4-11(15)16(12)19/h2-8,17-18H,1H3 |
| InChIKey | ZZAJQOPSWWVMBI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Andira inermis (ncbitaxon:53825) | leaf (BTO:0000713) | PubMed (11025148) | |
| Astragalus membranaceus (ncbitaxon:649199) | root (BTO:0001188) | PubMed (17253088) | |
| Bowdichia nitida (IPNI:482138-1) | - | Article (LIEBIGS ANN CHEM,1974,1295) | |
| Bowdichia virgilioides (IPNI:482144-1) | xylem (BTO:0001468) | PubMed (16286304) | Previous component: wood; |
| Cyclolobium claussenii (IPNI:489268-1) | - | DOI (10.1016/0031-9422(75)80372-4) | |
| Machaerium mucronulatum (IPNI:505522-1) | - | DOI (10.1016/S0031-9422(00)94598-9) | |
| Milletia laurentii (IPNI:507419-1) | heartwood (PO:0004512) | DOI (10.1016/S0031-9422(99)00043-6) | |
| Myroxylon balsamum (ncbitaxon:53906) | - | DOI (10.1016/S0031-9422(00)89391-7) | |
| Myroxylon peruiferum (IPNI:509454-1) | - | DOI (10.1016/0031-9422(79)80020-5) | |
| Psorothamnus arborescens (ncbitaxon:248527) | root (BTO:0001188) | PubMed (16441066) | |
| Sophora secundiflora (ncbitaxon:48122) | - | DOI (10.1016/S0040-4039(00)78784-3) | |
| Trifolium pratense (ncbitaxon:57577) | - | DOI (10.1016/S0031-9422(00)94679-X) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calycosin (CHEBI:17793) has functional parent isoflavone (CHEBI:18220) |
| calycosin (CHEBI:17793) has role antioxidant (CHEBI:22586) |
| calycosin (CHEBI:17793) has role metabolite (CHEBI:25212) |
| calycosin (CHEBI:17793) is a 4'-methoxyisoflavones (CHEBI:133959) |
| calycosin (CHEBI:17793) is a 7-hydroxyisoflavones (CHEBI:55465) |
| calycosin (CHEBI:17793) is conjugate acid of calycosin(1−) (CHEBI:77992) |
| Incoming Relation(s) |
| calycosin-7-O-β-D-glucoside (CHEBI:86512) has functional parent calycosin (CHEBI:17793) |
| calycosin(1−) (CHEBI:77992) is conjugate base of calycosin (CHEBI:17793) |
| IUPAC Name |
|---|
| 7-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3'-hydroxy-formononetin | ChEBI |
| 7,3'-dihydroxy-4'-methoxyisoflavone | ChEBI |
| 7-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| 7-Hydroxy-3-(3-hydroxy-4-methoxyphenyl)chromen-4-one | ChemIDplus |
| Calycosin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00009389 | KNApSAcK |
| C01562 | KEGG COMPOUND |
| Calycosin | Wikipedia |
| CN102030735 | Patent |
| KR20080079237 | Patent |
| LMPK12050056 | LIPID MAPS |
| WO2009129260 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1292488 | Reaxys |
| CAS:20575-57-9 | ChemIDplus |
| CAS:20575-57-9 | KEGG COMPOUND |
| Citations |
|---|