EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7O4 |
| Net Charge | -1 |
| Average Mass | 191.162 |
| Monoisotopic Mass | 191.03498 |
| SMILES | Cc1cc(=O)c2c(O)cc([O-])cc2o1 |
| InChI | InChI=1S/C10H8O4/c1-5-2-7(12)10-8(13)3-6(11)4-9(10)14-5/h2-4,11,13H,1H3/p-1 |
| InChIKey | NCUJRUDLFCGVOE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| noreugenin(1−) (CHEBI:77977) has role plant metabolite (CHEBI:76924) |
| noreugenin(1−) (CHEBI:77977) is a phenolate anion (CHEBI:50525) |
| noreugenin(1−) (CHEBI:77977) is conjugate base of noreugenin (CHEBI:67375) |
| Incoming Relation(s) |
| noreugenin (CHEBI:67375) is conjugate acid of noreugenin(1−) (CHEBI:77977) |
| IUPAC Name |
|---|
| 5-hydroxy-2-methyl-4-oxo-4H-chromen-7-olate |
| UniProt Name | Source |
|---|---|
| 5,7-dihydroxy-2-methyl-4H-chromen-4-one | UniProt |