EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O4 |
| Net Charge | 0 |
| Average Mass | 192.170 |
| Monoisotopic Mass | 192.04226 |
| SMILES | Cc1cc(=O)c2c(O)cc(O)cc2o1 |
| InChI | InChI=1S/C10H8O4/c1-5-2-7(12)10-8(13)3-6(11)4-9(10)14-5/h2-4,11,13H,1H3 |
| InChIKey | NCUJRUDLFCGVOE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| noreugenin (CHEBI:67375) has role plant metabolite (CHEBI:76924) |
| noreugenin (CHEBI:67375) is a chromones (CHEBI:23238) |
| noreugenin (CHEBI:67375) is a resorcinols (CHEBI:33572) |
| noreugenin (CHEBI:67375) is conjugate acid of noreugenin(1−) (CHEBI:77977) |
| Incoming Relation(s) |
| noreugenin(1−) (CHEBI:77977) is conjugate base of noreugenin (CHEBI:67375) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-methyl-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 5,7-dihydroxy-2-methyl-4H-1-benzopyran-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C20462 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:158224 | Reaxys |
| Citations |
|---|