EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H9O7 |
| Net Charge | -1 |
| Average Mass | 337.263 |
| Monoisotopic Mass | 337.03538 |
| SMILES | [H][C@]12OC=C[C@@]1([H])c1c(cc3c(c1O)C(=O)c1c(O)cc([O-])cc1C3=O)O2 |
| InChI | InChI=1S/C18H10O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h1-5,7,18-20,23H/p-1/t7-,18+/m0/s1 |
| InChIKey | SJNDYXPJRUTLNW-ULCDLSAGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| versicolorin A(1−) (CHEBI:77976) is a phenolate anion (CHEBI:50525) |
| versicolorin A(1−) (CHEBI:77976) is conjugate base of versicolorin A (CHEBI:72676) |
| Incoming Relation(s) |
| versicolorin A (CHEBI:72676) is conjugate acid of versicolorin A(1−) (CHEBI:77976) |
| IUPAC Name |
|---|
| (3aS,12aR)-4,6-dihydroxy-5,10-dioxo-3a,5,10,12a-tetrahydroanthra[2,3-b]furo[3,2-d]furan-8-olate |
| UniProt Name | Source |
|---|---|
| versicolorin A | UniProt |