EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H10O7 |
| Net Charge | 0 |
| Average Mass | 338.271 |
| Monoisotopic Mass | 338.04265 |
| SMILES | [H][C@]12OC=C[C@@]1([H])c1c(cc3c(c1O)C(=O)c1c(O)cc(O)cc1C3=O)O2 |
| InChI | InChI=1S/C18H10O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h1-5,7,18-20,23H/t7-,18+/m0/s1 |
| InChIKey | SJNDYXPJRUTLNW-ULCDLSAGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus parasiticus (ncbitaxon:5067) | - | PubMed (22103394) |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| versicolorin A (CHEBI:72676) has role Aspergillus metabolite (CHEBI:76956) |
| versicolorin A (CHEBI:72676) has role carcinogenic agent (CHEBI:50903) |
| versicolorin A (CHEBI:72676) is a p-quinones (CHEBI:25830) |
| versicolorin A (CHEBI:72676) is a cyclic acetal (CHEBI:59770) |
| versicolorin A (CHEBI:72676) is a organic heteropentacyclic compound (CHEBI:38164) |
| versicolorin A (CHEBI:72676) is a polyphenol (CHEBI:26195) |
| versicolorin A (CHEBI:72676) is conjugate acid of versicolorin A(1−) (CHEBI:77976) |
| Incoming Relation(s) |
| (4S,8R,16R)-2,13,16,20-tetrahydroxy-7,9-dioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,5,10,13,19-hexaen-18-one (CHEBI:150860) has functional parent versicolorin A (CHEBI:72676) |
| (4S,8R)-2,13,16,20-tetrahydroxy-7,9-dioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,5,10,13,16,19-heptaen-18-one (CHEBI:150859) has functional parent versicolorin A (CHEBI:72676) |
| versicolorin A(1−) (CHEBI:77976) is conjugate base of versicolorin A (CHEBI:72676) |
| IUPAC Name |
|---|
| (3aS,12aR)-4,6,8-trihydroxy-3a,12a-dihydroanthra[2,3-b]furo[3,2-d]furan-5,10-dione |
| Synonym | Source |
|---|---|
| Z-(-)-4,6,8-Trihydroxy-3a,12a-dihydroanthra(2,3-b)furo(3,2-d)furan-5,10-dione | ChemIDplus |
| Citations |
|---|