EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17O8 |
| Net Charge | -1 |
| Average Mass | 385.348 |
| Monoisotopic Mass | 385.09289 |
| SMILES | CC(=O)CCC[C@H](O)c1c(O)cc2c(c1O)C(=O)c1c(O)cc([O-])cc1C2=O |
| InChI | InChI=1S/C20H18O8/c1-8(21)3-2-4-12(23)17-14(25)7-11-16(20(17)28)19(27)15-10(18(11)26)5-9(22)6-13(15)24/h5-7,12,22-25,28H,2-4H2,1H3/p-1/t12-/m0/s1 |
| InChIKey | JJDSVOQKAOJVOK-LBPRGKRZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-5'-oxoaverantin(1−) (CHEBI:77933) is a phenolate anion (CHEBI:50525) |
| (S)-5'-oxoaverantin(1−) (CHEBI:77933) is conjugate base of (S)-5'-oxoaverantin (CHEBI:71649) |
| Incoming Relation(s) |
| (S)-5'-oxoaverantin (CHEBI:71649) is conjugate acid of (S)-5'-oxoaverantin(1−) (CHEBI:77933) |
| IUPAC Name |
|---|
| 4,5,7-trihydroxy-6-[(1S)-1-hydroxy-5-oxohexyl]-9,10-dioxo-9,10-dihydroanthracen-2-olate |
| UniProt Name | Source |
|---|---|
| (S)-5'-oxoaverantin | UniProt |
| Citations |
|---|