EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O8 |
| Net Charge | 0 |
| Average Mass | 386.356 |
| Monoisotopic Mass | 386.10017 |
| SMILES | CC(=O)CCC[C@H](O)c1c(O)cc2c(c1O)C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C20H18O8/c1-8(21)3-2-4-12(23)17-14(25)7-11-16(20(17)28)19(27)15-10(18(11)26)5-9(22)6-13(15)24/h5-7,12,22-25,28H,2-4H2,1H3/t12-/m0/s1 |
| InChIKey | JJDSVOQKAOJVOK-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-5'-oxoaverantin (CHEBI:71649) has role metabolite (CHEBI:25212) |
| (S)-5'-oxoaverantin (CHEBI:71649) is a methyl ketone (CHEBI:51867) |
| (S)-5'-oxoaverantin (CHEBI:71649) is a polyketide (CHEBI:26188) |
| (S)-5'-oxoaverantin (CHEBI:71649) is a polyphenol (CHEBI:26195) |
| (S)-5'-oxoaverantin (CHEBI:71649) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| (S)-5'-oxoaverantin (CHEBI:71649) is conjugate acid of (S)-5'-oxoaverantin(1−) (CHEBI:77933) |
| Incoming Relation(s) |
| (S)-5'-oxoaverantin(1−) (CHEBI:77933) is conjugate base of (S)-5'-oxoaverantin (CHEBI:71649) |
| IUPAC Name |
|---|
| 1,3,6,8-tetrahydroxy-2-[(1S)-1-hydroxy-5-oxohexyl]-9,10-anthraquinone |
| Synonyms | Source |
|---|---|
| 5'-ketoaverantin | MetaCyc |
| OAVN | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| CPD-10166 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15827980 | Reaxys |
| Citations |
|---|