EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O7 |
| Net Charge | 0 |
| Average Mass | 502.648 |
| Monoisotopic Mass | 502.29305 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@@]1([H])C[C@@]1(CO[C@H]3C[C@@H]4OC(C)(C)O[C@@H]4[C@@H](C)O3)[C@]3(C(=O)O)C(C(C)C)=C[C@]1([H])C[C@]23C=O |
| InChI | InChI=1S/C29H42O7/c1-15(2)21-9-18-11-27(13-30)20-8-7-16(3)19(20)12-28(18,29(21,27)25(31)32)14-33-23-10-22-24(17(4)34-23)36-26(5,6)35-22/h9,13,15-20,22-24H,7-8,10-12,14H2,1-6H3,(H,31,32)/t16-,17-,18-,19-,20-,22+,23-,24-,27+,28+,29+/m1/s1 |
| InChIKey | YIJXUKFDZCRZIC-MYOGCEHNSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GM 193663 (CHEBI:77908) has functional parent sordarin (CHEBI:52549) |
| GM 193663 (CHEBI:77908) has role antifungal agent (CHEBI:35718) |
| GM 193663 (CHEBI:77908) has role protein synthesis inhibitor (CHEBI:48001) |
| GM 193663 (CHEBI:77908) is a glycoside (CHEBI:24400) |
| GM 193663 (CHEBI:77908) is a monosaccharide derivative (CHEBI:63367) |
| GM 193663 (CHEBI:77908) is a semisynthetic derivative (CHEBI:72588) |
| GM 193663 (CHEBI:77908) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (1S,3aR,4S,4aR,7R,7aR,8aS)-8a-{[(2,6-dideoxy-3,4-O-isopropylidene-β-D-ribo-hexopyranosyl)oxy]methyl}-4-formyl-3-isopropyl-7-methyl-4,4a,5,6,7,7a,8,8a-octahydro-1,4-methano-s-indacene-3a(1H)-carboxylic acid |
| Synonyms | Source |
|---|---|
| GM193663 | ChemIDplus |
| GM193663A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:178970-36-0 | ChemIDplus |
| Citations |
|---|