EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O8 |
| Net Charge | 0 |
| Average Mass | 492.609 |
| Monoisotopic Mass | 492.27232 |
| SMILES | [H][C@@]1(OC[C@@]23C[C@]4([H])[C@H](C)CC[C@@]4([H])[C@@]4(C=O)C[C@]2([H])C=C(C(C)C)[C@]43C(=O)O)O[C@H](C)[C@@H](OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H40O8/c1-13(2)19-8-16-9-25(11-28)18-7-6-14(3)17(18)10-26(16,27(19,25)24(31)32)12-34-23-21(30)20(29)22(33-5)15(4)35-23/h8,11,13-18,20-23,29-30H,6-7,9-10,12H2,1-5H3,(H,31,32)/t14-,15-,16+,17-,18-,20+,21+,22-,23-,25+,26+,27+/m1/s1 |
| InChIKey | OGGVRVMISBQNMQ-YPBSLCSMSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sordarin (CHEBI:52549) has role antifungal agent (CHEBI:35718) |
| sordarin (CHEBI:52549) has role protein synthesis inhibitor (CHEBI:48001) |
| sordarin (CHEBI:52549) is a glycoside (CHEBI:24400) |
| sordarin (CHEBI:52549) is a monosaccharide derivative (CHEBI:63367) |
| sordarin (CHEBI:52549) is a tetracyclic diterpenoid (CHEBI:52557) |
| Incoming Relation(s) |
| GM 193663 (CHEBI:77908) has functional parent sordarin (CHEBI:52549) |
| IUPAC Name |
|---|
| (1R,3aR,4S,4aR,7R,7aR,8aS)-8a-{[(6-deoxy-4-O-methyl-β-D-altropyranosyl)oxy]methyl}-4-formyl-7-methyl-3-(propan-2-yl)-4,4a,5,6,7,7a,8,8a-octahydro-1,4-methano-s-indacene-3a(1H)-carboxylic acid |
| Synonyms | Source |
|---|---|
| sordarin B | SUBMITTER |
| Antibiotic SL-2266 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:11076-17-8 | SUBMITTER |
| CAS:11076-17-8 | ChemIDplus |