EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15N3O7 |
| Net Charge | -2 |
| Average Mass | 397.343 |
| Monoisotopic Mass | 397.09210 |
| SMILES | O=C(N[C@H]1CN([C@@H](C(=O)[O-])c2ccc(O)cc2)C1=O)/C(=N\[O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C19H17N3O7/c23-12-5-1-10(2-6-12)15(21-29)17(25)20-14-9-22(18(14)26)16(19(27)28)11-3-7-13(24)8-4-11/h1-8,14,16,23-24,29H,9H2,(H,20,25)(H,27,28)/p-2/b21-15-/t14-,16+/m0/s1 |
| InChIKey | NMMOYDKOFASOBV-HKHZIIAMSA-L |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocardicin E(2−) (CHEBI:77885) has role antimicrobial agent (CHEBI:33281) |
| nocardicin E(2−) (CHEBI:77885) is a monocarboxylic acid anion (CHEBI:35757) |
| nocardicin E(2−) (CHEBI:77885) is conjugate base of nocardicin E(1−) (CHEBI:58610) |
| Incoming Relation(s) |
| nocardicin E(1−) (CHEBI:58610) is conjugate acid of nocardicin E(2−) (CHEBI:77885) |
| IUPAC Name |
|---|
| (2R)-(4-hydroxyphenyl)[(3S)-3-{[(2Z)-2-(4-hydroxyphenyl)-2-(oxidoimino)acetyl]amino}-2-oxoazetidin-1-yl]acetate |
| UniProt Name | Source |
|---|---|
| nocardicin E | UniProt |