EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N3O7 |
| Net Charge | -1 |
| Average Mass | 398.351 |
| Monoisotopic Mass | 398.09937 |
| SMILES | O=C(N[C@H]1CN([C@@H](C(=O)[O-])c2ccc(O)cc2)C1=O)/C(=N\O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H17N3O7/c23-12-5-1-10(2-6-12)15(21-29)17(25)20-14-9-22(18(14)26)16(19(27)28)11-3-7-13(24)8-4-11/h1-8,14,16,23-24,29H,9H2,(H,20,25)(H,27,28)/p-1/b21-15-/t14-,16+/m0/s1 |
| InChIKey | NMMOYDKOFASOBV-HKHZIIAMSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocardicin E(1−) (CHEBI:58610) is a monocarboxylic acid anion (CHEBI:35757) |
| nocardicin E(1−) (CHEBI:58610) is conjugate acid of nocardicin E(2−) (CHEBI:77885) |
| nocardicin E(1−) (CHEBI:58610) is conjugate base of nocardicin E (CHEBI:29091) |
| Incoming Relation(s) |
| nocardicin E (CHEBI:29091) is conjugate acid of nocardicin E(1−) (CHEBI:58610) |
| nocardicin E(2−) (CHEBI:77885) is conjugate base of nocardicin E(1−) (CHEBI:58610) |
| IUPAC Name |
|---|
| (2R)-{(3S)-3-[(2Z)-2-(hydroxyimino)-2-(4-hydroxyphenyl)acetamido]-2-oxoazetidin-1-yl}(4-hydroxyphenyl)acetate |